C9H11N5O3 — CID 112598017
1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 112598017) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598017 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cn1cnnc1CCN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C9H11N5O3/c1-13-5-10-12-6(13)2-3-14-8(16)4-7(15)11-9(14)17/h5H,2-4H2,1H3,(H,11,15,17) |
| InChIKey | NCVJUTSBYOOYAI-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|