C8H12N2O2S — CID 106433144
1-(2-prop-2-enylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 106433144) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-(2-prop-2-enylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | 1-(2-prop-2-enylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106433144 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(2-prop-2-enylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | C=CCSCCN1CC(=O)NC1=O |
| InChI | InChI=1S/C8H12N2O2S/c1-2-4-13-5-3-10-6-7(11)9-8(10)12/h2H,1,3-6H2,(H,9,11,12) |
| InChIKey | HVKFEAMCJSXLLN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|