C22H42N2S — CID 139774138
1-(2-prop-2-enylsulfanylethyl)-2-tetradecyl-4,5-dihydroimidazole (PubChem CID 139774138) has the molecular formula C22H42N2S and a molecular weight of 366.66 g/mol. Its IUPAC name is 1-(2-prop-2-enylsulfanylethyl)-2-tetradecyl-4,5-dihydroimidazole.
| Compound Name | 1-(2-prop-2-enylsulfanylethyl)-2-tetradecyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 139774138 |
| Molecular Formula | C22H42N2S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 1-(2-prop-2-enylsulfanylethyl)-2-tetradecyl-4,5-dihydroimidazole |
| SMILES | C=CCSCCN1CCN=C1CCCCCCCCCCCCCC |
| InChI | InChI=1S/C22H42N2S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-22-23-17-18-24(22)19-21-25-20-4-2/h4H,2-3,5-21H2,1H3 |
| InChIKey | IHYQMZLSNQINMP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|