C18H38N4 — CID 3016399
N'-[2-(2-undecyl-4,5-dihydroimidazol-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 3016399) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is N'-[2-(2-undecyl-4,5-dihydroimidazol-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-undecyl-4,5-dihydroimidazol-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 3016399 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | N'-[2-(2-undecyl-4,5-dihydroimidazol-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCCCCC1=NCCN1CCNCCN |
| InChI | InChI=1S/C18H38N4/c1-2-3-4-5-6-7-8-9-10-11-18-21-15-17-22(18)16-14-20-13-12-19/h20H,2-17,19H2,1H3 |
| InChIKey | SPRVNAMHCBVRJW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|