C9H19N3 — CID 69018271
(2-pentyl-4,5-dihydroimidazol-1-yl)methanamine (PubChem CID 69018271) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (2-pentyl-4,5-dihydroimidazol-1-yl)methanamine.
| Compound Name | (2-pentyl-4,5-dihydroimidazol-1-yl)methanamine |
|---|---|
| PubChem CID | 69018271 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (2-pentyl-4,5-dihydroimidazol-1-yl)methanamine |
| SMILES | CCCCCC1=NCCN1CN |
| InChI | InChI=1S/C9H19N3/c1-2-3-4-5-9-11-6-7-12(9)8-10/h2-8,10H2,1H3 |
| InChIKey | ONWAVQYYCUXZKA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|