C19H38N2 — CID 67928425
1-pentyl-2-undecyl-4,5-dihydroimidazole (PubChem CID 67928425) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 1-pentyl-2-undecyl-4,5-dihydroimidazole.
| Compound Name | 1-pentyl-2-undecyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 67928425 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 1-pentyl-2-undecyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCCCCC1=NCCN1CCCCC |
| InChI | InChI=1S/C19H38N2/c1-3-5-7-8-9-10-11-12-13-15-19-20-16-18-21(19)17-14-6-4-2/h3-18H2,1-2H3 |
| InChIKey | NESXMRIQRWTYLI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|