C13H14N2O4 — CID 167995684
4-[3-(2,4-dioxoimidazolidin-1-yl)propoxy]benzaldehyde (PubChem CID 167995684) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[3-(2,4-dioxoimidazolidin-1-yl)propoxy]benzaldehyde.
| Compound Name | 4-[3-(2,4-dioxoimidazolidin-1-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 167995684 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-[3-(2,4-dioxoimidazolidin-1-yl)propoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCCCN2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H14N2O4/c16-9-10-2-4-11(5-3-10)19-7-1-6-15-8-12(17)14-13(15)18/h2-5,9H,1,6-8H2,(H,14,17,18) |
| InChIKey | PMJSKHZNDHSIAB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|