C7H12N4O3 — CID 76587988
3-(2,5-dioxopiperazin-1-yl)-N'-hydroxypropanimidamide (PubChem CID 76587988) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(2,5-dioxopiperazin-1-yl)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2,5-dioxopiperazin-1-yl)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76587988 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-(2,5-dioxopiperazin-1-yl)-N'-hydroxypropanimidamide |
| SMILES | NC(CCN1CC(=O)NCC1=O)=NO |
| InChI | InChI=1S/C7H12N4O3/c8-5(10-14)1-2-11-4-6(12)9-3-7(11)13/h14H,1-4H2,(H2,8,10)(H,9,12) |
| InChIKey | JSSJSWQVBYFNHY-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|