C9H14N2O2 — CID 64956054
1-(cyclobutylmethyl)piperazine-2,5-dione (PubChem CID 64956054) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)piperazine-2,5-dione.
| Compound Name | 1-(cyclobutylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64956054 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(cyclobutylmethyl)piperazine-2,5-dione |
| SMILES | O=C1CN(CC2CCC2)C(=O)CN1 |
| InChI | InChI=1S/C9H14N2O2/c12-8-6-11(9(13)4-10-8)5-7-2-1-3-7/h7H,1-6H2,(H,10,12) |
| InChIKey | ZBLOXGDWJNVQPN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |