C10H16N2O3 — CID 64955690
1-(oxan-3-ylmethyl)piperazine-2,5-dione (PubChem CID 64955690) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-(oxan-3-ylmethyl)piperazine-2,5-dione.
| Compound Name | 1-(oxan-3-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64955690 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(oxan-3-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1CN(CC2CCCOC2)C(=O)CN1 |
| InChI | InChI=1S/C10H16N2O3/c13-9-6-12(10(14)4-11-9)5-8-2-1-3-15-7-8/h8H,1-7H2,(H,11,13) |
| InChIKey | NGPCXWRXRJPYML-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |