C11H18N2O2 — CID 83249029
6-(oxan-3-ylmethyl)-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83249029) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-(oxan-3-ylmethyl)-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 6-(oxan-3-ylmethyl)-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83249029 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-(oxan-3-ylmethyl)-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | O=C1N(CC2CCCOC2)CNC12CC2 |
| InChI | InChI=1S/C11H18N2O2/c14-10-11(3-4-11)12-8-13(10)6-9-2-1-5-15-7-9/h9,12H,1-8H2 |
| InChIKey | JFZUGDNSVWSHBP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |