About 1-propyl-1,3-diazinane-2,5-dione
1-propyl-1,3-diazinane-2,5-dione (PubChem CID 155748543) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-propyl-1,3-diazinane-2,5-dione.
Molecular Properties
| Compound Name | 1-propyl-1,3-diazinane-2,5-dione |
| PubChem CID | 155748543 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-propyl-1,3-diazinane-2,5-dione |
| SMILES | CCCN1CC(=O)CNC1=O |
| InChI | InChI=1S/C7H12N2O2/c1-2-3-9-5-6(10)4-8-7(9)11/h2-5H2,1H3,(H,8,11) |
| InChIKey | IUWRTKNSVLRNIW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propyl-1,3-diazinane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-1,3-diazinane-2,5-dione?
The IUPAC name of 1-propyl-1,3-diazinane-2,5-dione (CID 155748543) is 1-propyl-1,3-diazinane-2,5-dione.
What is the SMILES notation for 1-propyl-1,3-diazinane-2,5-dione?
The canonical SMILES for 1-propyl-1,3-diazinane-2,5-dione is CCCN1CC(=O)CNC1=O.
What is the InChIKey of 1-propyl-1,3-diazinane-2,5-dione?
The InChIKey is IUWRTKNSVLRNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-2-3-9-5-6(10)4-8-7(9)11/h2-5H2,1H3,(H,8,11).
What are the key properties of 1-propyl-1,3-diazinane-2,5-dione?
1-propyl-1,3-diazinane-2,5-dione has a molecular weight of 156.19 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-1,3-diazinane-2,5-dione is sourced from PubChem (CID 155748543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).