C12H24N2O — CID 117023599
2,2,6,6-tetramethyl-4-propyl-1,4-diazepan-5-one (PubChem CID 117023599) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-propyl-1,4-diazepan-5-one.
| Compound Name | 2,2,6,6-tetramethyl-4-propyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023599 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-propyl-1,4-diazepan-5-one |
| SMILES | CCCN1CC(C)(C)NCC(C)(C)C1=O |
| InChI | InChI=1S/C12H24N2O/c1-6-7-14-9-12(4,5)13-8-11(2,3)10(14)15/h13H,6-9H2,1-5H3 |
| InChIKey | UMAGTQSIFXECKE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |