C26H50N4O4 — CID 59109305
3,3,5,5-tetramethyl-1-[3-[4-[3-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propoxy]butoxy]propyl]piperazin-2-one (PubChem CID 59109305) has the molecular formula C26H50N4O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[3-[4-[3-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propoxy]butoxy]propyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-[3-[4-[3-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propoxy]butoxy]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 59109305 |
| Molecular Formula | C26H50N4O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[3-[4-[3-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propoxy]butoxy]propyl]piperazin-2-one |
| SMILES | CC1(C)CN(CCCOCCCCOCCCN2CC(C)(C)NC(C)(C)C2=O)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C26H50N4O4/c1-23(2)19-29(21(31)25(5,6)27-23)13-11-17-33-15-9-10-16-34-18-12-14-30-20-24(3,4)28-26(7,8)22(30)32/h27-28H,9-20H2,1-8H3 |
| InChIKey | KLHVDEVQVUTAEE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|