C11H22N2O2 — CID 117023648
4-(3-methoxypropyl)-2,2-dimethyl-1,4-diazepan-5-one (PubChem CID 117023648) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-2,2-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(3-methoxypropyl)-2,2-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023648 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-(3-methoxypropyl)-2,2-dimethyl-1,4-diazepan-5-one |
| SMILES | COCCCN1CC(C)(C)NCCC1=O |
| InChI | InChI=1S/C11H22N2O2/c1-11(2)9-13(7-4-8-15-3)10(14)5-6-12-11/h12H,4-9H2,1-3H3 |
| InChIKey | JWMGZQILAMQGDX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|