C10H18N2O — CID 117023640
4-cyclopropyl-2,2-dimethyl-1,4-diazepan-5-one (PubChem CID 117023640) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-cyclopropyl-2,2-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-cyclopropyl-2,2-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023640 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 4-cyclopropyl-2,2-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CN(C2CC2)C(=O)CCN1 |
| InChI | InChI=1S/C10H18N2O/c1-10(2)7-12(8-3-4-8)9(13)5-6-11-10/h8,11H,3-7H2,1-2H3 |
| InChIKey | PZBSJASJTNUHHR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |