About 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide
2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 117016676) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide.
Analyze 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide?
The IUPAC name of 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide (CID 117016676) is 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide.
What is the SMILES notation for 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide?
The canonical SMILES for 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide is CC1(C)CN(C2CC2)S(=O)(=O)CCN1.
What is the InChIKey of 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide?
The InChIKey is RPKMDXFALWKONH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-9(2)7-11(8-3-4-8)14(12,13)6-5-10-9/h8,10H,3-7H2,1-2H3.
What are the key properties of 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide?
2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide has a molecular weight of 218.32 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4,4-dimethyl-1,2,5-thiadiazepane 1,1-dioxide is sourced from PubChem (CID 117016676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).