C12H24N2O2S — CID 117016611
2-cyclopentyl-3,3-dimethyl-1,2,5-thiadiazocane 1,1-dioxide (PubChem CID 117016611) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-cyclopentyl-3,3-dimethyl-1,2,5-thiadiazocane 1,1-dioxide.
| Compound Name | 2-cyclopentyl-3,3-dimethyl-1,2,5-thiadiazocane 1,1-dioxide |
|---|---|
| PubChem CID | 117016611 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-cyclopentyl-3,3-dimethyl-1,2,5-thiadiazocane 1,1-dioxide |
| SMILES | CC1(C)CNCCCS(=O)(=O)N1C1CCCC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-12(2)10-13-8-5-9-17(15,16)14(12)11-6-3-4-7-11/h11,13H,3-10H2,1-2H3 |
| InChIKey | GTRLDMVIZRAMOL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |