C11H22N2O — CID 65460906
2,2-dimethyl-1-(oxan-3-yl)piperazine (PubChem CID 65460906) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,2-dimethyl-1-(oxan-3-yl)piperazine.
| Compound Name | 2,2-dimethyl-1-(oxan-3-yl)piperazine |
|---|---|
| PubChem CID | 65460906 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2,2-dimethyl-1-(oxan-3-yl)piperazine |
| SMILES | CC1(C)CNCCN1C1CCCOC1 |
| InChI | InChI=1S/C11H22N2O/c1-11(2)9-12-5-6-13(11)10-4-3-7-14-8-10/h10,12H,3-9H2,1-2H3 |
| InChIKey | DBVQYKNLWGCVBZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |