C12H22N2O3S — CID 115100525
4-(1,1-dioxothian-3-yl)-6,6-dimethyl-1,4-diazepan-5-one (PubChem CID 115100525) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-(1,1-dioxothian-3-yl)-6,6-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(1,1-dioxothian-3-yl)-6,6-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 115100525 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(1,1-dioxothian-3-yl)-6,6-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CNCCN(C2CCCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C12H22N2O3S/c1-12(2)9-13-5-6-14(11(12)15)10-4-3-7-18(16,17)8-10/h10,13H,3-9H2,1-2H3 |
| InChIKey | WKTTYAIOXHEPFM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |