C14H26N2O2S — CID 102849442
3-(2,8-diazaspiro[5.5]undecan-2-yl)thiane 1,1-dioxide (PubChem CID 102849442) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-(2,8-diazaspiro[5.5]undecan-2-yl)thiane 1,1-dioxide.
| Compound Name | 3-(2,8-diazaspiro[5.5]undecan-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 102849442 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-(2,8-diazaspiro[5.5]undecan-2-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(N2CCCC3(CCCNC3)C2)C1 |
| InChI | InChI=1S/C14H26N2O2S/c17-19(18)9-1-4-13(10-19)16-8-3-6-14(12-16)5-2-7-15-11-14/h13,15H,1-12H2 |
| InChIKey | UJRKOONDJSOAPF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |