C13H24N2O2S — CID 64925182
3-(1,4-diazaspiro[5.5]undecan-4-yl)thiolane 1,1-dioxide (PubChem CID 64925182) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 3-(1,4-diazaspiro[5.5]undecan-4-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(1,4-diazaspiro[5.5]undecan-4-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64925182 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(1,4-diazaspiro[5.5]undecan-4-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCNC3(CCCCC3)C2)C1 |
| InChI | InChI=1S/C13H24N2O2S/c16-18(17)9-4-12(10-18)15-8-7-14-13(11-15)5-2-1-3-6-13/h12,14H,1-11H2 |
| InChIKey | AJLZWVABNYFGHP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |