C8H13F2NO2S — CID 117007587
3-(3,3-difluoropyrrolidin-1-yl)thiolane 1,1-dioxide (PubChem CID 117007587) has the molecular formula C8H13F2NO2S and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-(3,3-difluoropyrrolidin-1-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(3,3-difluoropyrrolidin-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117007587 |
| Molecular Formula | C8H13F2NO2S |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(3,3-difluoropyrrolidin-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C8H13F2NO2S/c9-8(10)2-3-11(6-8)7-1-4-14(12,13)5-7/h7H,1-6H2 |
| InChIKey | CEFJPRGDZWPWSB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |