C11H15N3O2S — CID 117007905
1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile (PubChem CID 117007905) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 117007905 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile |
| SMILES | N#CC1(C#N)CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H15N3O2S/c12-8-11(9-13)2-4-14(5-3-11)10-1-6-17(15,16)7-10/h10H,1-7H2 |
| InChIKey | FLEUVCJXTJPLHE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |