About 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile
1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile (PubChem CID 117007905) has the molecular formula C11H15N3O2S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile |
| PubChem CID | 117007905 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile |
| SMILES | N#CC1(C#N)CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H15N3O2S/c12-8-11(9-13)2-4-14(5-3-11)10-1-6-17(15,16)7-10/h10H,1-7H2 |
| InChIKey | FLEUVCJXTJPLHE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile (CID 117007905) is 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile is N#CC1(C#N)CCN(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile?
The InChIKey is FLEUVCJXTJPLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S/c12-8-11(9-13)2-4-14(5-3-11)10-1-6-17(15,16)7-10/h10H,1-7H2.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile?
1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile has a molecular weight of 253.33 g/mol, XLogP of 0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)piperidine-4,4-dicarbonitrile is sourced from PubChem (CID 117007905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).