C11H19N3O2S — CID 82120809
3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile (PubChem CID 82120809) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 82120809 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile |
| SMILES | N#CCCN1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H19N3O2S/c12-3-1-4-13-5-7-14(8-6-13)11-2-9-17(15,16)10-11/h11H,1-2,4-10H2 |
| InChIKey | UPCOMWGXIUMBBU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |