C17H24BrN3O3S — CID 112840363
N-(4-bromophenyl)-3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanamide (PubChem CID 112840363) has the molecular formula C17H24BrN3O3S and a molecular weight of 430.37 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 112840363 |
| Molecular Formula | C17H24BrN3O3S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-(4-bromophenyl)-3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(C2CCS(=O)(=O)C2)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrN3O3S/c18-14-1-3-15(4-2-14)19-17(22)5-7-20-8-10-21(11-9-20)16-6-12-25(23,24)13-16/h1-4,16H,5-13H2,(H,19,22) |
| InChIKey | WXJQAVZGRNRWCG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |