C11H22N2O3S — CID 63312824
2-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]ethanol (PubChem CID 63312824) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63312824 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S1(=O)CCC(N2CCCN(CCO)CC2)C1 |
| InChI | InChI=1S/C11H22N2O3S/c14-8-7-12-3-1-4-13(6-5-12)11-2-9-17(15,16)10-11/h11,14H,1-10H2 |
| InChIKey | VHSOUEPRNVWUHS-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |