About 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine
3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine (PubChem CID 54914507) has the molecular formula C12H25N3O2S
and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine |
| PubChem CID | 54914507 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine |
| SMILES | CC(CN)CN1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C12H25N3O2S/c1-11(8-13)9-14-3-5-15(6-4-14)12-2-7-18(16,17)10-12/h11-12H,2-10,13H2,1H3 |
| InChIKey | HBBMHFHRNNOVEV-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine?
The IUPAC name of 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine (CID 54914507) is 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine.
What is the SMILES notation for 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine?
The canonical SMILES for 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine is CC(CN)CN1CCN(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine?
The InChIKey is HBBMHFHRNNOVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2S/c1-11(8-13)9-14-3-5-15(6-4-14)12-2-7-18(16,17)10-12/h11-12H,2-10,13H2,1H3.
What are the key properties of 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine?
3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine has a molecular weight of 275.42 g/mol, XLogP of -0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 54914507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).