C13H27N3O2S — CID 54914463
4-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 54914463) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is 4-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 54914463 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[4-(1,1-dioxothiolan-3-yl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | NCCCCN1CCCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H27N3O2S/c14-5-1-2-6-15-7-3-8-16(10-9-15)13-4-11-19(17,18)12-13/h13H,1-12,14H2 |
| InChIKey | ZRVLZLFFIZPBPE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|