C11H22N2O2S — CID 63922407
3-(6-methyl-1,4-diazepan-1-yl)thiane 1,1-dioxide (PubChem CID 63922407) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-(6-methyl-1,4-diazepan-1-yl)thiane 1,1-dioxide.
| Compound Name | 3-(6-methyl-1,4-diazepan-1-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 63922407 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(6-methyl-1,4-diazepan-1-yl)thiane 1,1-dioxide |
| SMILES | CC1CNCCN(C2CCCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C11H22N2O2S/c1-10-7-12-4-5-13(8-10)11-3-2-6-16(14,15)9-11/h10-12H,2-9H2,1H3 |
| InChIKey | IMUWUPSWSJDJMK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |