C12H24N2O2S — CID 63922163
1-(1,1-dioxothian-3-yl)-N,3-dimethylpiperidin-4-amine (PubChem CID 63922163) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-N,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(1,1-dioxothian-3-yl)-N,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 63922163 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-N,3-dimethylpiperidin-4-amine |
| SMILES | CNC1CCN(C2CCCS(=O)(=O)C2)CC1C |
| InChI | InChI=1S/C12H24N2O2S/c1-10-8-14(6-5-12(10)13-2)11-4-3-7-17(15,16)9-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | IOCHHSXVYYEVED-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |