C11H19F3N2O2S — CID 115101656
3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiane 1,1-dioxide (PubChem CID 115101656) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiane 1,1-dioxide.
| Compound Name | 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115101656 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(N2CCCNCC2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2S/c12-11(13,14)10-7-15-4-2-5-16(10)9-3-1-6-19(17,18)8-9/h9-10,15H,1-8H2 |
| InChIKey | MBZOUQVMVPJMRM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |