C11H17F3N2O3S — CID 115101509
1-(1,1-dioxothian-4-yl)-2-(trifluoromethyl)-1,4-diazepan-5-one (PubChem CID 115101509) has the molecular formula C11H17F3N2O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-2-(trifluoromethyl)-1,4-diazepan-5-one.
| Compound Name | 1-(1,1-dioxothian-4-yl)-2-(trifluoromethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 115101509 |
| Molecular Formula | C11H17F3N2O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-2-(trifluoromethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C2CCS(=O)(=O)CC2)C(C(F)(F)F)CN1 |
| InChI | InChI=1S/C11H17F3N2O3S/c12-11(13,14)9-7-15-10(17)1-4-16(9)8-2-5-20(18,19)6-3-8/h8-9H,1-7H2,(H,15,17) |
| InChIKey | IPKMMNYODMKFRT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |