C11H18N2O4S — CID 64960953
1-(1,1-dioxothian-4-yl)-3-methyl-1,4-diazepane-2,5-dione (PubChem CID 64960953) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-3-methyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(1,1-dioxothian-4-yl)-3-methyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64960953 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-3-methyl-1,4-diazepane-2,5-dione |
| SMILES | CC1NC(=O)CCN(C2CCS(=O)(=O)CC2)C1=O |
| InChI | InChI=1S/C11H18N2O4S/c1-8-11(15)13(5-2-10(14)12-8)9-3-6-18(16,17)7-4-9/h8-9H,2-7H2,1H3,(H,12,14) |
| InChIKey | PTKCFDBULKEEFJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |