C9H16N2O3S — CID 83243464
3-(1,1-dioxothian-4-yl)-5-methylimidazolidin-4-one (PubChem CID 83243464) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-methylimidazolidin-4-one.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 83243464 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-methylimidazolidin-4-one |
| SMILES | CC1NCN(C2CCS(=O)(=O)CC2)C1=O |
| InChI | InChI=1S/C9H16N2O3S/c1-7-9(12)11(6-10-7)8-2-4-15(13,14)5-3-8/h7-8,10H,2-6H2,1H3 |
| InChIKey | JKIXCNFSVCMIMI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |