C14H18N2O3S — CID 83243785
3-(1,1-dioxothian-4-yl)-5-phenylimidazolidin-4-one (PubChem CID 83243785) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-phenylimidazolidin-4-one.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-phenylimidazolidin-4-one |
|---|---|
| PubChem CID | 83243785 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-phenylimidazolidin-4-one |
| SMILES | O=C1C(c2ccccc2)NCN1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18N2O3S/c17-14-13(11-4-2-1-3-5-11)15-10-16(14)12-6-8-20(18,19)9-7-12/h1-5,12-13,15H,6-10H2 |
| InChIKey | KXURQCZVJIUCQJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |