C11H20N2O — CID 114552415
3-(3,3-dimethylcyclopentyl)-5-methylimidazolidin-4-one (PubChem CID 114552415) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-(3,3-dimethylcyclopentyl)-5-methylimidazolidin-4-one.
| Compound Name | 3-(3,3-dimethylcyclopentyl)-5-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 114552415 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-(3,3-dimethylcyclopentyl)-5-methylimidazolidin-4-one |
| SMILES | CC1NCN(C2CCC(C)(C)C2)C1=O |
| InChI | InChI=1S/C11H20N2O/c1-8-10(14)13(7-12-8)9-4-5-11(2,3)6-9/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | QSXRKQSATNIPSA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |