C14H24N2O — CID 114552438
3-(3,3-dimethylcyclopentyl)-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 114552438) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-(3,3-dimethylcyclopentyl)-1,3-diazaspiro[4.4]nonan-4-one.
| Compound Name | 3-(3,3-dimethylcyclopentyl)-1,3-diazaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 114552438 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-(3,3-dimethylcyclopentyl)-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | CC1(C)CCC(N2CNC3(CCCC3)C2=O)C1 |
| InChI | InChI=1S/C14H24N2O/c1-13(2)8-5-11(9-13)16-10-15-14(12(16)17)6-3-4-7-14/h11,15H,3-10H2,1-2H3 |
| InChIKey | XGHNGZBEKMEWDS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |