C13H22N2O — CID 83258358
6-(2-methylcycloheptyl)-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83258358) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-(2-methylcycloheptyl)-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 6-(2-methylcycloheptyl)-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83258358 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 6-(2-methylcycloheptyl)-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CC1CCCCCC1N1CNC2(CC2)C1=O |
| InChI | InChI=1S/C13H22N2O/c1-10-5-3-2-4-6-11(10)15-9-14-13(7-8-13)12(15)16/h10-11,14H,2-9H2,1H3 |
| InChIKey | IBMQOTUYWDEJJJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |