C15H26N2O — CID 83258739
3-(3,5-dimethylcyclohexyl)-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 83258739) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-(3,5-dimethylcyclohexyl)-1,3-diazaspiro[4.4]nonan-4-one.
| Compound Name | 3-(3,5-dimethylcyclohexyl)-1,3-diazaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 83258739 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 3-(3,5-dimethylcyclohexyl)-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | CC1CC(C)CC(N2CNC3(CCCC3)C2=O)C1 |
| InChI | InChI=1S/C15H26N2O/c1-11-7-12(2)9-13(8-11)17-10-16-15(14(17)18)5-3-4-6-15/h11-13,16H,3-10H2,1-2H3 |
| InChIKey | XIBQAVYVGPTTMM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |