C12H20BrNO — CID 114541337
3-bromo-1-(3,3-dimethylcyclopentyl)piperidin-2-one (PubChem CID 114541337) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 3-bromo-1-(3,3-dimethylcyclopentyl)piperidin-2-one.
| Compound Name | 3-bromo-1-(3,3-dimethylcyclopentyl)piperidin-2-one |
|---|---|
| PubChem CID | 114541337 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-bromo-1-(3,3-dimethylcyclopentyl)piperidin-2-one |
| SMILES | CC1(C)CCC(N2CCCC(Br)C2=O)C1 |
| InChI | InChI=1S/C12H20BrNO/c1-12(2)6-5-9(8-12)14-7-3-4-10(13)11(14)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | CCRVFADJYLRQMT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|