C11H18BrNO2 — CID 130992749
3-bromo-1-(2,5-dimethyloxolan-3-yl)piperidin-2-one (PubChem CID 130992749) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 3-bromo-1-(2,5-dimethyloxolan-3-yl)piperidin-2-one.
| Compound Name | 3-bromo-1-(2,5-dimethyloxolan-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 130992749 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-bromo-1-(2,5-dimethyloxolan-3-yl)piperidin-2-one |
| SMILES | CC1CC(N2CCCC(Br)C2=O)C(C)O1 |
| InChI | InChI=1S/C11H18BrNO2/c1-7-6-10(8(2)15-7)13-5-3-4-9(12)11(13)14/h7-10H,3-6H2,1-2H3 |
| InChIKey | VVOWQWFNBFBFKB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|