C10H18N2O3S — CID 115101910
1-(1,1-dioxothian-3-yl)-3-methylpiperazin-2-one (PubChem CID 115101910) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-3-methylpiperazin-2-one.
| Compound Name | 1-(1,1-dioxothian-3-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 115101910 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-3-methylpiperazin-2-one |
| SMILES | CC1NCCN(C2CCCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C10H18N2O3S/c1-8-10(13)12(5-4-11-8)9-3-2-6-16(14,15)7-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | AXKFKRGHWIXLEO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |