C9H14N2O4S — CID 64956222
1-(1,1-dioxothian-3-yl)piperazine-2,5-dione (PubChem CID 64956222) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)piperazine-2,5-dione.
| Compound Name | 1-(1,1-dioxothian-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64956222 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)piperazine-2,5-dione |
| SMILES | O=C1CN(C2CCCS(=O)(=O)C2)C(=O)CN1 |
| InChI | InChI=1S/C9H14N2O4S/c12-8-5-11(9(13)4-10-8)7-2-1-3-16(14,15)6-7/h7H,1-6H2,(H,10,12) |
| InChIKey | VSISYMNDCWZCSU-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |