C8H12N2O4S — CID 103936410
3-(1,1-dioxothian-3-yl)imidazolidine-2,4-dione (PubChem CID 103936410) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)imidazolidine-2,4-dione.
| Compound Name | 3-(1,1-dioxothian-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103936410 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N2O4S/c11-7-4-9-8(12)10(7)6-2-1-3-15(13,14)5-6/h6H,1-5H2,(H,9,12) |
| InChIKey | DOLXPIPSVQHNGS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|