C9H12N2O5S — CID 112598032
1-(1,1-dioxothian-3-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 112598032) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1,1-dioxothian-3-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598032 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(C2CCCS(=O)(=O)C2)C(=O)N1 |
| InChI | InChI=1S/C9H12N2O5S/c12-7-4-8(13)11(9(14)10-7)6-2-1-3-17(15,16)5-6/h6H,1-5H2,(H,10,12,14) |
| InChIKey | AEKDACAMFIJBRQ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|