C11H20N2O3S — CID 83257943
3-(1,1-dioxothian-3-yl)-2-propan-2-ylimidazolidin-4-one (PubChem CID 83257943) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-2-propan-2-ylimidazolidin-4-one.
| Compound Name | 3-(1,1-dioxothian-3-yl)-2-propan-2-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83257943 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-2-propan-2-ylimidazolidin-4-one |
| SMILES | CC(C)C1NCC(=O)N1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-8(2)11-12-6-10(14)13(11)9-4-3-5-17(15,16)7-9/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | YLEJMZIWOIGNHA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |