C11H18N2O3S — CID 117005417
4-cyclopentyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 117005417) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 4-cyclopentyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | 4-cyclopentyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 117005417 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-cyclopentyl-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1CNC2CS(=O)(=O)CC2N1C1CCCC1 |
| InChI | InChI=1S/C11H18N2O3S/c14-11-5-12-9-6-17(15,16)7-10(9)13(11)8-3-1-2-4-8/h8-10,12H,1-7H2 |
| InChIKey | KFSQESOFYCGWCR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |