C12H19NO3S — CID 6553677
(3aR,6aS)-1-cyclohexyl-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 6553677) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is (3aR,6aS)-1-cyclohexyl-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | (3aR,6aS)-1-cyclohexyl-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 6553677 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (3aR,6aS)-1-cyclohexyl-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CS(=O)(=O)C[C@H]2N1C1CCCCC1 |
| InChI | InChI=1S/C12H19NO3S/c14-12-6-9-7-17(15,16)8-11(9)13(12)10-4-2-1-3-5-10/h9-11H,1-8H2/t9-,11+/m0/s1 |
| InChIKey | SSMBOYUBKSVYSU-GXSJLCMTSA-N |
| XLogP | 0.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |