C10H15NO — CID 102300255
(2S,4R,8S)-1-azatricyclo[6.3.0.02,4]undecan-11-one (PubChem CID 102300255) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S,4R,8S)-1-azatricyclo[6.3.0.02,4]undecan-11-one.
| Compound Name | (2S,4R,8S)-1-azatricyclo[6.3.0.02,4]undecan-11-one |
|---|---|
| PubChem CID | 102300255 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S,4R,8S)-1-azatricyclo[6.3.0.02,4]undecan-11-one |
| SMILES | O=C1CC[C@@H]2CCC[C@@H]3C[C@@H]3N12 |
| InChI | InChI=1S/C10H15NO/c12-10-5-4-8-3-1-2-7-6-9(7)11(8)10/h7-9H,1-6H2/t7-,8+,9+/m1/s1 |
| InChIKey | FRPLFAJJMUPJED-VGMNWLOBSA-N |
| XLogP | 1.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |